You are viewing a free preview of this lesson.
Subscribe to unlock all 10 lessons in this course and every other course on LearningBro.
This lesson covers the addition (compound angle) formulae for sin, cos, and tan. These formulae allow you to expand expressions like sin(A + B) and cos(A − B), and they are fundamental to much of the trigonometry at A-Level — including double angle formulae, the R cos(θ + α) form, and proving identities.
sin(A + B) ≡ sin A cos B + cos A sin B
sin(A − B) ≡ sin A cos B − cos A sin B
cos(A + B) ≡ cos A cos B − sin A sin B
cos(A − B) ≡ cos A cos B + sin A sin B
Note the sign pattern: in the cos formulae, the sign in the expansion is opposite to the sign in the argument.
tan(A + B) ≡ (tan A + tan B) / (1 − tan A tan B)
tan(A − B) ≡ (tan A − tan B) / (1 + tan A tan B)
These formulae are in the AQA formula booklet, but you must be able to use them fluently.
Consider two points P and Q on the unit circle, where P is at angle A and Q is at angle B from the positive x-axis. Then:
P = (cos A, sin A) and Q = (cos B, sin B)
The distance PQ can be found using the distance formula:
PQ² = (cos A − cos B)² + (sin A − sin B)²
= cos²A − 2cos A cos B + cos²B + sin²A − 2sin A sin B + sin²B
= (cos²A + sin²A) + (cos²B + sin²B) − 2(cos A cos B + sin A sin B)
= 1 + 1 − 2(cos A cos B + sin A sin B)
= 2 − 2(cos A cos B + sin A sin B)
Alternatively, using the cosine rule in the triangle with vertices O, P, Q (with OP = OQ = 1 and angle POQ = A − B):
PQ² = 1² + 1² − 2(1)(1)cos(A − B) = 2 − 2cos(A − B)
Equating the two expressions for PQ²:
2 − 2cos(A − B) = 2 − 2(cos A cos B + sin A sin B)
cos(A − B) = cos A cos B + sin A sin B
The other formulae can be derived from this one by substitution.
Replace B with −B in cos(A − B):
cos(A + B) = cos A cos(−B) + sin A sin(−B)
= cos A cos B − sin A sin B
(using cos(−B) = cos B and sin(−B) = −sin B)
Use the identity sin θ = cos(π/2 − θ):
sin(A + B) = cos(π/2 − (A + B))
= cos((π/2 − A) − B)
= cos(π/2 − A)cos B + sin(π/2 − A)sin B
= sin A cos B + cos A sin B
tan(A + B) = sin(A + B) / cos(A + B)
= (sin A cos B + cos A sin B) / (cos A cos B − sin A sin B)
Divide numerator and denominator by cos A cos B:
= (tan A + tan B) / (1 − tan A tan B)
Example 1: Find the exact value of sin 75°.
75° = 45° + 30°, so:
sin 75° = sin(45° + 30°)
= sin 45° cos 30° + cos 45° sin 30°
= (√2/2)(√3/2) + (√2/2)(1/2)
= √6/4 + √2/4
= (√6 + √2)/4
Example 2: Find the exact value of cos 15°.
15° = 45° − 30°, so:
cos 15° = cos(45° − 30°)
= cos 45° cos 30° + sin 45° sin 30°
= (√2/2)(√3/2) + (√2/2)(1/2)
= √6/4 + √2/4
= (√6 + √2)/4
Note: sin 75° = cos 15° — as expected, since 75° + 15° = 90°.
Example 3: Find the exact value of tan 75°.
tan 75° = tan(45° + 30°)
= (tan 45° + tan 30°) / (1 − tan 45° tan 30°)
= (1 + 1/√3) / (1 − 1/√3)
Multiply numerator and denominator by √3:
= (√3 + 1) / (√3 − 1)
Rationalise:
= (√3 + 1)² / ((√3 − 1)(√3 + 1))
= (3 + 2√3 + 1) / (3 − 1)
= (4 + 2√3) / 2
= 2 + √3
Example 4: Solve sin(x + π/3) = 1/2 for 0 ≤ x ≤ 2π.
x + π/3 = π/6 + 2nπ or x + π/3 = π − π/6 + 2nπ = 5π/6 + 2nπ
From x + π/3 = π/6: x = π/6 − π/3 = −π/6 (not in range) From x + π/3 = 5π/6: x = 5π/6 − π/3 = 5π/6 − 2π/6 = 3π/6 = π/2 ✓
For n = 1: From x + π/3 = π/6 + 2π = 13π/6: x = 13π/6 − π/3 = 13π/6 − 2π/6 = 11π/6 ✓ From x + π/3 = 5π/6 + 2π = 17π/6: x = 17π/6 − π/3 = 15π/6 = 5π/2 > 2π (out of range)
Solutions: x = π/2, 11π/6
Example 5: Given that sin(x + 30°) = 2cos(x − 30°), find tan x.
Expand both sides:
sin x cos 30° + cos x sin 30° = 2(cos x cos 30° + sin x sin 30°)
(√3/2)sin x + (1/2)cos x = 2(√3/2)cos x + 2(1/2)sin x
(√3/2)sin x + (1/2)cos x = √3 cos x + sin x
Rearranging:
(√3/2)sin x − sin x = √3 cos x − (1/2)cos x
sin x(√3/2 − 1) = cos x(√3 − 1/2)
sin x(√3 − 2)/2 = cos x(2√3 − 1)/2
tan x = (2√3 − 1)/(√3 − 2)
Rationalise by multiplying by (√3 + 2)/(√3 + 2):
= (2√3 − 1)(√3 + 2) / ((√3 − 2)(√3 + 2))
= (2 × 3 + 4√3 − √3 − 2) / (3 − 4)
= (6 + 3√3 − 2) / (−1)
= (4 + 3√3) / (−1)
= −4 − 3√3
Example 6: Prove that cos(A + B) + cos(A − B) ≡ 2cos A cos B.
LHS = (cos A cos B − sin A sin B) + (cos A cos B + sin A sin B)
= 2cos A cos B
= RHS ∎
Example 7: Prove that sin(A + B)sin(A − B) ≡ sin²A − sin²B.
LHS = (sin A cos B + cos A sin B)(sin A cos B − cos A sin B)
= sin²A cos²B − cos²A sin²B
= sin²A(1 − sin²B) − (1 − sin²A)sin²B
= sin²A − sin²A sin²B − sin²B + sin²A sin²B
= sin²A − sin²B
= RHS ∎
Exam Tip: When using addition formulae, be very careful with signs — especially in the cos formula, where the sign in the expansion is opposite to the sign in the argument. Write out the formula first before substituting values. In "show that" questions, show every step clearly. The most common error is a sign mistake.
AQA 7357 specification, Paper 2 — Pure Mathematics, Section E (Trigonometry), sub-strand E5 covers the addition formulae for sine, cosine and tangent; understand and use double-angle formulae as a special case (refer to the official specification document for exact wording). The compound-angle formulae sin(A±B), cos(A±B) and tan(A±B) are printed in the AQA formula booklet, but candidates are still expected to apply them fluently in proof, equation-solving and modelling contexts. Compound-angle work is examined across Section E (trig identities and equations), Section J (integration via product-to-sum substitution), Section L (proof) and (in mechanics, 7357/2) within force-resolution problems where Rsin(θ+α) harmonic form is used to model oscillations.
Question (8 marks):
(a) Without using a calculator, find the exact value of sin(75°), expressing your answer in the form ca+b where a, b and c are integers. (4)
(b) Hence, or otherwise, prove that sin(75°)−sin(15°)=22. (4)
Solution with mark scheme:
(a) Step 1 — express 75° as a sum of standard angles.
75°=45°+30°
M1 — choosing a decomposition into angles whose sine and cosine are exactly known. 75°=60°+15° does not help (since 15° is itself unknown), and 75°=90°−15° converts to cos(15°) which still requires compound angles. The cleanest split is 45°+30°.
Step 2 — apply the addition formula for sine.
sin(45°+30°)=sin45°cos30°+cos45°sin30°
M1 — correct quotation of sin(A+B)=sinAcosB+cosAsinB. Sign and ordering must match exactly; writing sinAsinB+cosAcosB (the formula for cos(A−B)) loses both M1s and the subsequent A1.
Step 3 — substitute exact values.
Using sin45°=cos45°=22, sin30°=21, cos30°=23:
sin(75°)=22⋅23+22⋅21=46+42
A1 — correct substitution and simplification of each product. Note 22⋅23=46, not 45 — surd multiplication, not addition.
Step 4 — combine into requested form.
sin(75°)=46+2
A1 — final form with a=6, b=2, c=4.
(b) Step 1 — find sin(15°) by analogous decomposition.
15°=45°−30°, so:
sin(15°)=sin45°cos30°−cos45°sin30°=46−42=46−2
M1 — correct application of sin(A−B)=sinAcosB−cosAsinB, noting the sign change relative to part (a).
A1 — correct exact value for sin(15°).
Step 2 — subtract.
sin(75°)−sin(15°)=46+2−46−2=422=22
M1 — correct subtraction with the 6 terms cancelling.
A1 — final exact answer matching the printed result 22, completing the proof.
Total: 8 marks (M4 A4).
Question (6 marks): Prove that, for all real A and B for which both sides are defined,
cosAcosBsin(A+B)=tanA+tanB
Hence find the exact value of tan(15°)+tan(30°) in surd form, given that sin(45°)=22 and cos(15°)cos(30°)=46+2⋅23. (6)
Mark scheme decomposition by AO:
cosAcosBsinAcosB+cosAsinB=cosAsinA+cosBsinB=tanA+tanB
Total: 6 marks split AO1 = 4, AO2 = 1, AO3 = 1. AQA loads compound-angle proof questions toward AO1/AO2 — the technique is procedural, but the connecting move (recognising that the printed identity is the engine of the numerical part) is the AO3 reasoning the synoptic mark rewards.
Connects to:
Double-angle formulae as special case (Section E): setting A=B in sin(A+B) gives sin(2A)=2sinAcosA. Likewise cos(2A)=cos2A−sin2A, with the alternative forms 1−2sin2A and 2cos2A−1 following from the Pythagorean identity. Compound-angle formulae are the parent identities; double-angle formulae are their A=B degeneration. Examiners exploit this — a question stated in compound-angle form often reduces to double-angle work.
Harmonic form Rsin(θ+α) (Section E): expanding Rsin(θ+α)=Rsinθcosα+Rcosθsinα shows that asinθ+bcosθ can always be rewritten as a single sinusoid with R=a2+b2 and tanα=b/a. This is the engine of every "find the maximum/minimum of 3sinθ+4cosθ" question and underpins phasor analysis in physics.
Trigonometric equations (Section E): equations like sin(2x)=cos(x) are unsolvable until sin(2x) is expanded as 2sinxcosx, after which the equation factorises as cosx(2sinx−1)=0. Compound and double-angle expansion is the gateway technique for non-trivial trig equations.
Product-to-sum and integration (Section J): the identities 2sinAcosB=sin(A+B)+sin(A−B) and 2cosAcosB=cos(A−B)+cos(A+B) are derived directly from the addition formulae. They convert products (which cannot be integrated directly) into sums (which can), making integrals like ∫sin(3x)cos(x)dx accessible.
Complex numbers and Euler (Further Maths but signposted): ei(A+B)=eiA⋅eiB expanded using Euler's formula eiθ=cosθ+isinθ produces both cos(A+B) and sin(A+B) formulae simultaneously by comparing real and imaginary parts. This is the slickest derivation and previews university-level approaches.
Compound-angle questions on AQA 7357 split AO marks across all three objectives:
Subscribe to continue reading
Get full access to this lesson and all 10 lessons in this course.